CAS 953720-72-4

α-Methyl-2-oxo-1(2H)-pyrimidineacetic acid

Description:

α-Methyl-2-oxo-1(2H)-pyrimidineacetic acid, identified by its CAS number 953720-72-4, is a chemical compound that features a pyrimidine ring, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound is characterized by the presence of a methyl group and a keto group, contributing to its reactivity and potential biological activity. It typically exhibits properties such as solubility in polar solvents, which is common for compounds containing carboxylic acid functional groups. The presence of the pyrimidine structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or antiviral agents, as pyrimidine derivatives are often explored for their biological properties. Additionally, the compound may participate in various chemical reactions, including condensation and substitution reactions, due to the functional groups present. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₇H₈N₂O₃

InChI: InChI=1S/C7H8N2O3/c1-5(6(10)11)9-4-2-3-8-7(9)12/h2-5H,1H3,(H,10,11)

InChI key: InChIKey=OVEGTCZEHPXBMQ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)N1C(=O)N=CC=C1

Synonyms:

• α-Methyl-2-oxo-1(2H)-pyrimidineacetic acid
• 2-(2-Oxo-1,2-dihydropyrimidin-1-yl)propanoic acid
• 1(2H)-Pyrimidineacetic acid, α-methyl-2-oxo-