CAS 953732-43-9

N-(5-Amino-2-fluorophenyl)-2-phenoxyacetamide

Description:

N-(5-Amino-2-fluorophenyl)-2-phenoxyacetamide, identified by its CAS number 953732-43-9, is a chemical compound characterized by its specific functional groups and structural features. It contains an amine group, which contributes to its potential as a biological active molecule, particularly in pharmaceutical applications. The presence of a fluorine atom in the aromatic ring can enhance the compound's lipophilicity and metabolic stability, making it an interesting candidate for drug development. The phenoxyacetamide moiety suggests that it may exhibit interactions with biological targets, potentially influencing its pharmacological properties. This compound may be studied for its role in medicinal chemistry, particularly in the context of developing new therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be explored through various analytical methods, including spectroscopy and chromatography. Overall, N-(5-Amino-2-fluorophenyl)-2-phenoxyacetamide represents a class of compounds that could have significant implications in drug discovery and development.

Formula: C₁₄H₁₃FN₂O₂

InChI: InChI=1S/C14H13FN2O2/c15-12-7-6-10(16)8-13(12)17-14(18)9-19-11-4-2-1-3-5-11/h1-8H,9,16H2,(H,17,18)

InChI key: InChIKey=RXMNCVNDFQWCHE-UHFFFAOYSA-N

SMILES: N(C(COC1=CC=CC=C1)=O)C2=C(F)C=CC(N)=C2

Synonyms:

• Acetamide, N-(5-amino-2-fluorophenyl)-2-phenoxy-
• N-(5-Amino-2-fluorophenyl)-2-phenoxyacetamide