CAS 953735-83-6

3-Piperidinecarboxamide, 1-[(4-aminophenyl)methyl]-

Description:

3-Piperidinecarboxamide, 1-[(4-aminophenyl)methyl]- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N). The presence of a 4-aminophenyl group suggests that there is an aromatic ring with an amino substituent, which can influence the compound's reactivity and biological activity. This compound may exhibit properties such as solubility in polar solvents due to the amide and amino groups, and it could potentially engage in hydrogen bonding. Its structural features may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with piperidine and aromatic amine functionalities are often explored for their biological activities. However, specific biological activities, toxicity, and other detailed characteristics would require further empirical investigation and data.

Formula: C₁₃H₁₉N₃O

InChI: InChI=1S/C13H19N3O/c14-12-5-3-10(4-6-12)8-16-7-1-2-11(9-16)13(15)17/h3-6,11H,1-2,7-9,14H2,(H2,15,17)

InChI key: InChIKey=LTKSBKLJMOYVAC-UHFFFAOYSA-N

SMILES: C(N1CC(C(N)=O)CCC1)C2=CC=C(N)C=C2

Synonyms:

• 1-[(4-Aminophenyl)methyl]piperidine-3-carboxamide
• 3-Piperidinecarboxamide, 1-[(4-aminophenyl)methyl]-

1-[(4-Aminophenyl)methyl]piperidine-3-carboxamide

CAS: 953735-83-6

Versatile small molecule scaffold

Formula: C₁₃H₁₉N₃O

Purity: Min. 95%

Molecular weight: 233.31 g/mol

Ref: 3D-DNB73583