CymitQuimica logo

CAS 953749-60-5

:

N~1~,N~1~-dimethyl-1-(5-methylfuran-2-yl)ethane-1,2-diamine

Description:
N,N-Dimethyl-1-(5-methylfuran-2-yl)ethane-1,2-diamine is an organic compound characterized by its amine functional groups and a furan ring structure. This compound features two methyl groups attached to the nitrogen atoms, which can influence its solubility and reactivity. The presence of the furan ring, a five-membered aromatic heterocycle, contributes to its potential biological activity and chemical reactivity. Typically, compounds with amine functionalities can participate in hydrogen bonding, affecting their physical properties such as boiling and melting points. The specific arrangement of the substituents, including the 5-methylfuran moiety, may also impart unique properties, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's CAS number, 953749-60-5, allows for easy identification and retrieval of information related to its synthesis, applications, and safety data. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those containing both amine and heterocyclic structures.
Formula:C9H16N2O
InChI:InChI=1/C9H16N2O/c1-7-4-5-9(12-7)8(6-10)11(2)3/h4-5,8H,6,10H2,1-3H3
SMILES:Cc1ccc(C(CN)N(C)C)o1
Synonyms:
  • 1,2-ethanediamine, N1
  • N1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.