CAS 953751-31-0

3-[(2-Methyl-1H-imidazol-1-yl)methyl]benzenemethanamine

Description:

3-[(2-Methyl-1H-imidazol-1-yl)methyl]benzenemethanamine, identified by its CAS number 953751-31-0, is a chemical compound characterized by its complex structure that includes a benzene ring, an amine group, and an imidazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in polar solvents and the ability to engage in hydrogen bonding due to the presence of the amine and imidazole functionalities. The imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in pharmaceuticals and biologically active molecules. The presence of the methyl group on the imidazole can influence the compound's lipophilicity and reactivity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents that target specific biological pathways or receptors. Its specific physical and chemical properties, such as melting point, boiling point, and reactivity, would need to be determined through experimental methods or detailed literature review.

Formula: C₁₂H₁₅N₃

InChI: InChI=1S/C12H15N3/c1-10-14-5-6-15(10)9-12-4-2-3-11(7-12)8-13/h2-7H,8-9,13H2,1H3

InChI key: InChIKey=DVUPGUAHJJFIPS-UHFFFAOYSA-N

SMILES: C(N1C(C)=NC=C1)C2=CC(CN)=CC=C2

Synonyms:

• 3-[(2-Methyl-1H-imidazol-1-yl)methyl]benzenemethanamine
• Benzenemethanamine, 3-[(2-methyl-1H-imidazol-1-yl)methyl]-

{3-[(2-Methyl-1H-imidazol-1-yl)methyl]phenyl}methanamine

CAS: 953751-31-0

Versatile small molecule scaffold

Formula: C₁₂H₁₅N₃

Purity: Min. 95%

Molecular weight: 201.27 g/mol

Ref: 3D-DNB75131