CAS 953752-30-2

1-[4-(aminomethyl)benzyl]pyrrolidin-2-one

Description:

1-[4-(Aminomethyl)benzyl]pyrrolidin-2-one, identified by its CAS number 953752-30-2, is a chemical compound characterized by its unique molecular structure, which includes a pyrrolidinone ring and a benzyl group with an aminomethyl substituent. This compound typically exhibits properties associated with both amines and cyclic ketones, which may influence its solubility, reactivity, and potential biological activity. The presence of the aminomethyl group suggests that it may participate in hydrogen bonding and could serve as a site for further chemical modifications. Additionally, the pyrrolidinone moiety may contribute to its stability and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's characteristics, such as melting point, boiling point, and spectral data, would be essential for understanding its behavior in various chemical environments. Overall, 1-[4-(aminomethyl)benzyl]pyrrolidin-2-one is of interest for its potential applications in drug development and as a building block in organic synthesis.

Formula: C₁₂H₁₆N₂O

InChI: InChI=1/C12H16N2O/c13-8-10-3-5-11(6-4-10)9-14-7-1-2-12(14)15/h3-6H,1-2,7-9,13H2

SMILES: C1CC(=O)N(C1)Cc1ccc(cc1)CN

1-[4-(aminomethyl)benzyl]-2-pyrrolidinone

CAS: 953752-30-2

Formula: C₁₂H₁₆N₂O

Molecular weight: 204.2682

Ref: IN-DA006597

1-(4-Aminomethyl-benzyl)-pyrrolidin-2-one

CAS: 953752-30-2

Formula: C₁₂H₁₆N₂O

Purity: 95.0%

Molecular weight: 204.273

Ref: 10-F059058

1-(4-Aminomethyl-benzyl)-pyrrolidin-2-one

CAS: 953752-30-2

Versatile small molecule scaffold

Formula: C₁₂H₁₆N₂O

Purity: Min. 95%

Molecular weight: 204.27 g/mol

Ref: 3D-DNB75230