CAS 95378-00-0
:7-hydroxy-1-(2-methylprop-1-en-1-yl)-2-oxabenzo[g]naphtho[1,2,3-cd]azulene-8,13-dione
Description:
7-Hydroxy-1-(2-methylprop-1-en-1-yl)-2-oxabenzo[g]naphtho[1,2,3-cd]azulene-8,13-dione, with the CAS number 95378-00-0, is a complex organic compound characterized by its unique polycyclic structure, which includes a fused ring system. This compound features a hydroxyl group (-OH) at the 7-position, contributing to its potential reactivity and solubility in polar solvents. The presence of the 2-methylprop-1-en-1-yl substituent indicates that it has an alkene functional group, which can participate in various chemical reactions, such as electrophilic addition. The dione functionality suggests that it may exhibit keto-enol tautomerism, influencing its chemical behavior and stability. Additionally, the compound's structure may allow for interesting interactions with biological systems, making it a candidate for further research in medicinal chemistry or materials science. Its specific properties, such as melting point, boiling point, and solubility, would require empirical measurement or literature reference for precise characterization.
Formula:C24H16O4
InChI:InChI=1/C24H16O4/c1-12(2)11-17-18-19-20(22(26)14-8-4-3-7-13(14)21(18)25)23(27)15-9-5-6-10-16(15)24(19)28-17/h3-11,27H,1-2H3
Synonyms:- radermachol
- 9-Hydroxy-2-(2-methyl-1-propenyl)benzo[g]benzo[5,6]cyclohepta[1,2,3-cd]benzofuran-3,8-dione
- 7-hydroxy-1-(2-methylprop-1-en-1-yl)benzo[g]benzo[5,6]cyclohepta[1,2,3-cd]benzofuran-8,13-dione
- Benzo[g]benzo[5,6]cyclohepta[1,2,3-cd]benzofuran-3,8-dione, 9-hydroxy-2-(2-methyl-1-propenyl)- (9CI)
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Radermachol
CAS:Radermachol is a red pigment.Formula:C24H16O4Color and Shape:SolidMolecular weight:368.38
