CAS 953780-71-7

2-Pyridinemethanamine, 5-methoxy-α-methyl-, hydrochloride (1:1), (αR)-

Description:

2-Pyridinemethanamine, 5-methoxy-α-methyl-, hydrochloride (1:1), (αR)- is a chemical compound characterized by its pyridine and amine functional groups. It is a hydrochloride salt, which indicates that it is a protonated form of the base, enhancing its solubility in water. The presence of the methoxy group and the α-methyl substituent on the pyridine ring contributes to its unique chemical properties and potential biological activity. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its stereochemistry, denoted by (αR), suggests that it has specific spatial arrangements that can influence its interaction with biological targets. The compound's molecular structure allows for potential applications in drug development, particularly in areas related to neurochemistry or as a precursor in synthetic pathways. As with many amines, it may also participate in hydrogen bonding, affecting its reactivity and solubility. Proper handling and storage conditions are essential due to its classification and potential biological activity.

Formula: C₈H₁₂N₂O·ClH

InChI: InChI=1S/C8H12N2O.ClH/c1-6(9)8-4-3-7(11-2)5-10-8;/h3-6H,9H2,1-2H3;1H/t6-;/m1./s1

InChI key: InChIKey=SKJVRWVWDMKPFB-FYZOBXCZSA-N

SMILES: [C@H](C)(N)C1=CC=C(OC)C=N1.Cl

Synonyms:

• 2-Pyridinemethanamine, 5-methoxy-α-methyl-, hydrochloride (1:1), (αR)-