CAS 95380-42-0

2-[(4-methylpiperazin-1-yl)methyl]phenol

Description:

2-[(4-Methylpiperazin-1-yl)methyl]phenol, with the CAS number 95380-42-0, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a 4-methylpiperazine moiety contributes to its basicity and potential for forming hydrogen bonds, making it a versatile compound in medicinal chemistry. This substance typically exhibits moderate solubility in polar solvents due to the hydrophilic nature of the phenolic group and the piperazine ring. It may also display biological activity, potentially acting as a ligand in various biochemical pathways. The compound's molecular structure suggests it could participate in various chemical reactions, including alkylation and acylation, and may serve as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1/C12H18N2O/c1-13-6-8-14(9-7-13)10-11-4-2-3-5-12(11)15/h2-5,15H,6-10H2,1H3

SMILES: CN1CCN(CC1)Cc1ccccc1O

Synonyms:

• Phenol, 2-[(4-Methyl-1-Piperazinyl)Methyl]-