CAS 95383-37-2
:N-(2-BROMOETHYL)-4-FLUOROBENZAMIDE
Description:
N-(2-Bromoethyl)-4-fluorobenzamide is a chemical compound characterized by its unique structure, which includes a bromine atom and a fluorine atom attached to a benzamide moiety. The presence of the bromoethyl group suggests that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. The fluorine atom, known for its electronegativity, can influence the compound's reactivity and polarity, potentially enhancing its biological activity. This compound may exhibit properties such as moderate solubility in organic solvents and varying stability depending on environmental conditions. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the benzamide framework can lead to compounds with specific biological activities. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, N-(2-bromoethyl)-4-fluorobenzamide represents a versatile building block in chemical synthesis and drug development.
Formula:C9H9BrFNO
InChI:InChI=1/C9H9BrFNO/c1-5(10)8-4-6(11)2-3-7(8)9(12)13/h2-5H,1H3,(H2,12,13)
SMILES:CC(c1cc(ccc1C(=N)O)F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.