CymitQuimica logo

CAS 953897-07-9

:

5-Bromo-N-cyclopropyl-2-furanmethanamine

Description:
5-Bromo-N-cyclopropyl-2-furanmethanamine is a chemical compound characterized by its unique structure, which includes a furan ring, a bromine atom, and a cyclopropyl group. The presence of the furan moiety contributes to its potential reactivity and biological activity, as furan derivatives are often involved in various chemical reactions and can exhibit pharmacological properties. The bromine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. The cyclopropyl group is known for its strain and can impart unique steric and electronic properties, potentially affecting the compound's binding affinity and selectivity in biological systems. This compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c9-8-4-3-7(11-8)5-10-6-1-2-6/h3-4,6,10H,1-2,5H2
InChI key:InChIKey=QTBJSPYFSQIENE-UHFFFAOYSA-N
SMILES:C(NC1CC1)C2=CC=C(Br)O2
Synonyms:
  • 2-Furanmethanamine, 5-bromo-N-cyclopropyl-
  • 5-Bromo-N-cyclopropyl-2-furanmethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.