
CAS 954112-63-1
:2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
Description:
2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features an ethyl group at the 2-position of the pyrrole ring and an aldehyde functional group at the 3-position of the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of both nitrogen-containing rings enhances its biological activity, making it of interest in medicinal chemistry. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The compound's unique structure allows for various chemical modifications, which can lead to derivatives with enhanced properties. Its CAS number, 954112-63-1, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, 2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde is a valuable compound for research and development in pharmaceuticals and agrochemicals.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-2-9-8(6-13)7-4-3-5-11-10(7)12-9/h3-6H,2H2,1H3,(H,11,12)
InChI key:InChIKey=PTTWDZVQUXDATE-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1CC)=NC=CC2
Synonyms:- 2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
- 2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde
- 1H-Pyrrolo[2,3-b]pyridine-3-carboxaldehyde, 2-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.