CymitQuimica logo

CAS 954112-83-5

:

5-Chloro-2-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile

Description:
5-Chloro-2-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both pyrrole and pyridine rings. This compound features a chlorine atom and a cyano group (-CN) attached to the pyrrolopyridine framework, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the cyano group suggests potential reactivity, making it a candidate for various chemical transformations. Additionally, the chlorine substituent can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. Such compounds are often of interest in medicinal chemistry and drug development due to their structural complexity and potential pharmacological applications. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 5-Chloro-2-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile represents a valuable structure in the field of organic synthesis and pharmaceutical research.
Formula:C9H6ClN3
InChI:InChI=1S/C9H6ClN3/c1-5-8(3-11)7-2-6(10)4-12-9(7)13-5/h2,4H,1H3,(H,12,13)
InChI key:InChIKey=RCCZULSZEGALJI-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(NC1C)=NC=C(Cl)C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-3-carbonitrile, 5-chloro-2-methyl-
  • 5-Chloro-2-methyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.