
CAS 954112-84-6
:2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile
Description:
2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyridine ring fused to a pyrrole ring. This compound features a cyano group (-C≡N) at the 3-position of the pyrrole, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the ethyl group at the 2-position enhances its lipophilicity, which may influence its biological activity and solubility properties. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its synthesis often involves multi-step organic reactions, and it may serve as a building block for the development of pharmaceuticals or agrochemicals. Due to its structural complexity, 2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile may exhibit interesting electronic properties and could be investigated for various applications, including as a potential ligand in coordination chemistry or as a precursor in the synthesis of more complex molecules.
Formula:C10H9N3
InChI:InChI=1S/C10H9N3/c1-2-9-8(6-11)7-4-3-5-12-10(7)13-9/h3-5H,2H2,1H3,(H,12,13)
InChI key:InChIKey=QFMUKGXIYXZXTM-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(NC1CC)=NC=CC2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-3-carbonitrile, 2-ethyl-
- 2-Ethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.