CymitQuimica logo

CAS 954123-46-7

:

3-Bromo-5-(trifluoromethyl)benzyl bromide

Description:
3-Bromo-5-(trifluoromethyl)benzyl bromide is an organic compound characterized by its bromobenzyl structure, which includes a bromine atom at the 3-position and a trifluoromethyl group at the 5-position of the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the presence of multiple halogen atoms, making it useful in various chemical synthesis applications, particularly in the field of pharmaceuticals and agrochemicals. The trifluoromethyl group enhances the lipophilicity and metabolic stability of the compound, which can influence its biological activity. Additionally, the presence of bromine atoms can facilitate nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated nature. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.
Formula:C8H5Br2F3
InChI:InChI=1S/C8H5Br2F3/c9-4-5-1-6(8(11,12)13)3-7(10)2-5/h1-3H,4H2
InChI key:CRKZDDPRUZNPKL-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1C(F)(F)F)Br)CBr
Found 4 products.