CymitQuimica logo

CAS 954225-37-7

:

3-(2-Bromo-4-fluorophenoxy)azetidine

Description:
3-(2-Bromo-4-fluorophenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a phenoxy group, specifically a 2-bromo-4-fluorophenyl moiety, contributes to its unique properties and reactivity. The bromine and fluorine substituents on the aromatic ring can influence the compound's electronic characteristics, potentially enhancing its reactivity in various chemical reactions. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the presence of halogens can affect solubility and stability, impacting its application in different chemical environments. Overall, 3-(2-Bromo-4-fluorophenoxy)azetidine represents a versatile scaffold for further chemical modifications and investigations in both synthetic and medicinal chemistry contexts.
Formula:C9H9BrFNO
InChI:InChI=1S/C9H9BrFNO/c10-8-3-6(11)1-2-9(8)13-7-4-12-5-7/h1-3,7,12H,4-5H2
InChI key:InChIKey=FUXVAGGOBMYPDV-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(F)C=C1)C2CNC2
Synonyms:
  • Azetidine, 3-(2-bromo-4-fluorophenoxy)-
  • 3-(2-Bromo-4-fluorophenoxy)azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.