CAS 954225-55-9
:4-Chloro-2-(2-pyridinyl)quinoline
Description:
4-Chloro-2-(2-pyridinyl)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chloro substituent at the 4-position and a pyridinyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It may possess biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its synthesis involves standard organic reactions, including halogenation and heterocyclic chemistry techniques. As with many quinoline derivatives, it may exhibit fluorescence, making it useful in various analytical applications. Safety and handling precautions should be observed due to the presence of chlorine and potential toxicity associated with heterocyclic compounds.
Formula:C14H9ClN2
InChI:InChI=1S/C14H9ClN2/c15-11-9-14(13-7-3-4-8-16-13)17-12-6-2-1-5-10(11)12/h1-9H
InChI key:InChIKey=WXUGBJMXRJXJHZ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(C1)C3=CC=CC=N3)C=CC=C2
Synonyms:- 4-Chloro-2-(2-pyridinyl)quinoline
- Quinoline, 4-chloro-2-(2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
