CAS 954232-71-4
:2-Chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
Description:
2-Chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings. This compound features a chlorine atom at the 2-position and is known for its potential biological activity, making it of interest in medicinal chemistry. Its structure contributes to its reactivity and solubility properties, which can vary based on the presence of functional groups and the overall molecular framework. The compound may exhibit properties such as moderate to low solubility in water, with better solubility in organic solvents. It is often studied for its potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, 2-Chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine represents a significant compound in the field of organic and medicinal chemistry, with ongoing research into its properties and applications.
Formula:C6H6ClN3
InChI:InChI=1/C6H6ClN3/c7-6-9-2-4-1-8-3-5(4)10-6/h2,8H,1,3H2
SMILES:C1c2cnc(Cl)nc2CN1
Synonyms:- 5H-pyrrolo[3,4-d]pyrimidine, 2-chloro-6,7-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
