CAS 954232-71-4

2-Chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine

Description:

2-Chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings. This compound features a chlorine atom at the 2-position and is known for its potential biological activity, making it of interest in medicinal chemistry. Its structure contributes to its reactivity and solubility properties, which can vary based on the presence of functional groups and the overall molecular framework. The compound may exhibit properties such as moderate to low solubility in water, with better solubility in organic solvents. It is often studied for its potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, 2-Chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine represents a significant compound in the field of organic and medicinal chemistry, with ongoing research into its properties and applications.

Formula: C₆H₆ClN₃

InChI: InChI=1/C6H6ClN3/c7-6-9-2-4-1-8-3-5(4)10-6/h2,8H,1,3H2

SMILES: C1c2cnc(Cl)nc2CN1

Synonyms:

• 5H-pyrrolo[3,4-d]pyrimidine, 2-chloro-6,7-dihydro-

2-Chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine

CAS: 954232-71-4

Formula: C₆H₆ClN₃

Molecular weight: 155.5849

Ref: IN-DA0060AN