CAS 954240-02-9

[3-(3-fluorophenyl)isoxazol-5-yl]methanol

Description:

[3-(3-fluorophenyl)isoxazol-5-yl]methanol is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring, which can influence the compound's electronic properties and reactivity. The methanol functional group (-CH2OH) suggests that the compound has potential for hydrogen bonding, which can affect its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a candidate for research in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the presence of the fluorine atom, which can enhance lipophilicity and alter the compound's biological activity. Overall, [3-(3-fluorophenyl)isoxazol-5-yl]methanol represents a class of compounds that may have applications in drug development and other chemical research fields.

Formula: C₁₀H₈FNO₂

InChI: InChI=1/C10H8FNO2/c11-8-3-1-2-7(4-8)10-5-9(6-13)14-12-10/h1-5,13H,6H2

SMILES: c1cc(cc(c1)F)c1cc(CO)on1

(3-(3-Fluorophenyl)isoxazol-5-yl)methanol

CAS: 954240-02-9

Formula: C₁₀H₈FNO₂

Molecular weight: 193.1744

Ref: IN-DA0060AD

[3-(3-Fluorophenyl)isoxazol-5-yl]methanol

CAS: 954240-02-9

[3-(3-Fluorophenyl)isoxazol-5-yl]methanol

Purity: ≥95%

Molecular weight: 193.17g/mol

Ref: 54-PC200594

[3-(3-Fluoro-phenyl)-isoxazol-5-yl]-methanol

CAS: 954240-02-9

Purity: 95%

Molecular weight: 193.177002

Ref: 10-F873382