CAS 954240-10-9

[3-(3-methoxyphenyl)isoxazol-5-yl]methanol

Description:

[3-(3-methoxyphenyl)isoxazol-5-yl]methanol, with the CAS number 954240-10-9, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a methoxyphenyl group, indicating the presence of a methoxy (-OCH₃) substituent on a phenyl ring, which can influence its solubility and reactivity. The presence of the hydroxymethyl (-CH₂OH) group enhances its potential for hydrogen bonding, which may affect its biological activity and interactions with other molecules. The compound's isoxazole moiety is known for its applications in medicinal chemistry, often exhibiting various pharmacological properties. Its structural features suggest potential uses in drug development, particularly in areas targeting neurological or inflammatory conditions. The compound's stability, solubility, and reactivity can be influenced by the electronic effects of the methoxy group and the overall molecular conformation. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1/C11H11NO3/c1-14-9-4-2-3-8(5-9)11-6-10(7-13)15-12-11/h2-6,13H,7H2,1H3

SMILES: COc1cccc(c1)c1cc(CO)on1

(3-(3-Methoxyphenyl)isoxazol-5-yl)methanol

CAS: 954240-10-9

Formula: C₁₁H₁₁NO₃

Molecular weight: 205.2099

Ref: IN-DA00IJ3M