CAS 954240-26-7

tert-butyl 4-[[4-(methylamino)phenyl]methyl]piperazine-1-carboxylate

Description:

Tert-butyl 4-[[4-(methylamino)phenyl]methyl]piperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a piperazine ring, and a methylamino-substituted phenyl moiety. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, depending on the specific functional groups present. The presence of the piperazine ring suggests potential biological activity, as piperazine derivatives are often explored in medicinal chemistry for their pharmacological properties. The tert-butyl ester group may enhance lipophilicity, influencing the compound's absorption and distribution in biological systems. Additionally, the methylamino group can participate in hydrogen bonding and may affect the compound's interaction with biological targets. Overall, this compound's characteristics make it of interest in various fields, including pharmaceuticals and organic synthesis, where its unique structure could lead to novel applications or therapeutic agents.

Formula: C₁₇H₂₇N₃O₂

InChI: InChI=1/C17H27N3O2/c1-17(2,3)22-16(21)20-11-9-19(10-12-20)13-14-5-7-15(18-4)8-6-14/h5-8,18H,9-13H2,1-4H3

SMILES: CC(C)(C)OC(=O)N1CCN(CC1)Cc1ccc(cc1)NC

Synonyms:

• tert-Butyl 4-[4-(methylamino)benzyl]piperazine-1-carboxylate