CAS 954240-97-2
:1,6-Dihydro-5-hydroxy-2-methyl-6-oxo-4-pyrimidinecarboxamide
Description:
1,6-Dihydro-5-hydroxy-2-methyl-6-oxo-4-pyrimidinecarboxamide, with the CAS number 954240-97-2, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The compound is characterized by the presence of a carboxamide functional group, which contributes to its potential solubility in polar solvents. The hydroxyl group at position 5 and the methyl group at position 2 enhance its reactivity and may influence its biological activity. The keto group at position 6 indicates that it may participate in various chemical reactions, such as tautomerization or condensation. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C6H7N3O3
InChI:InChI=1S/C6H7N3O3/c1-2-8-3(5(7)11)4(10)6(12)9-2/h10H,1H3,(H2,7,11)(H,8,9,12)
InChI key:InChIKey=XGFVFFVDFVBTHS-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(O)C(=O)N=C(C)N1
Synonyms:- 4-Pyrimidinecarboxamide, 1,6-dihydro-5-hydroxy-2-methyl-6-oxo-
- 1,6-Dihydro-5-hydroxy-2-methyl-6-oxo-4-pyrimidinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
