CAS 954241-05-5
:1,6-Dihydro-5-hydroxy-2-(1-methylethyl)-6-oxo-4-pyrimidinecarboxylic acid
Description:
1,6-Dihydro-5-hydroxy-2-(1-methylethyl)-6-oxo-4-pyrimidinecarboxylic acid, identified by its CAS number 954241-05-5, is a pyrimidine derivative characterized by its unique structural features. This compound contains a pyrimidine ring, which is a six-membered aromatic ring with nitrogen atoms at the 1 and 3 positions. The presence of a hydroxyl group at the 5-position and a carboxylic acid group at the 4-position contributes to its acidic properties. The 6-oxo group indicates the presence of a carbonyl functional group, enhancing its reactivity and potential for forming hydrogen bonds. The isopropyl group at the 2-position adds to its hydrophobic character, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied.
Formula:C8H10N2O4
InChI:InChI=1S/C8H10N2O4/c1-3(2)6-9-4(8(13)14)5(11)7(12)10-6/h3,11H,1-2H3,(H,13,14)(H,9,10,12)
InChI key:InChIKey=HUPZUOCILSQWLB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1NC(C(C)C)=NC(=O)C1O
Synonyms:- 4-Pyrimidinecarboxylic acid, 1,6-dihydro-5-hydroxy-2-(1-methylethyl)-6-oxo-
- 1,6-Dihydro-5-hydroxy-2-(1-methylethyl)-6-oxo-4-pyrimidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
