
CAS 954241-09-9
:1,6-Dihydro-5-hydroxy-2-(4-methylphenyl)-6-oxo-4-pyrimidinecarboxylic acid
Description:
1,6-Dihydro-5-hydroxy-2-(4-methylphenyl)-6-oxo-4-pyrimidinecarboxylic acid, with the CAS number 954241-09-9, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic compound containing nitrogen atoms. This substance features a hydroxyl group and a carboxylic acid functional group, contributing to its potential as a biologically active molecule. The presence of the 4-methylphenyl substituent indicates that it has aromatic characteristics, which can influence its solubility and reactivity. The compound's structure suggests it may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups allows for potential interactions with biological targets, which could be explored in drug development. Its stability, solubility, and reactivity would depend on the specific conditions and solvents used in experiments. Overall, this compound represents a unique structure that may have applications in pharmaceuticals or agrochemicals.
Formula:C12H10N2O4
InChI:InChI=1S/C12H10N2O4/c1-6-2-4-7(5-3-6)10-13-8(12(17)18)9(15)11(16)14-10/h2-5,15H,1H3,(H,17,18)(H,13,14,16)
InChI key:InChIKey=WWIKOLOWSANPCN-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1NC(=NC(=O)C1O)C2=CC=C(C)C=C2
Synonyms:- 1,6-Dihydro-5-hydroxy-2-(4-methylphenyl)-6-oxo-4-pyrimidinecarboxylic acid
- 4-Pyrimidinecarboxylic acid, 1,6-dihydro-5-hydroxy-2-(4-methylphenyl)-6-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6-Dihydroxy-2-(p-tolyl)pyrimidine-4-carboxylic acid
CAS:Formula:C12H10N2O4Molecular weight:246.2188
