CAS 954241-17-9
:Octahydro-2-propylpyrrolo[3,4-c]pyrrole
Description:
Octahydro-2-propylpyrrolo[3,4-c]pyrrole, identified by its CAS number 954241-17-9, is a bicyclic organic compound characterized by its unique fused ring structure. This compound features a saturated framework, which contributes to its stability and potential applications in various fields, including pharmaceuticals and materials science. The presence of a propyl group enhances its hydrophobic properties, influencing its solubility and interaction with biological systems. Octahydro-2-propylpyrrolo[3,4-c]pyrrole may exhibit interesting chemical reactivity due to the nitrogen atoms in its structure, which can participate in hydrogen bonding and coordination with metal ions. Its structural features may also allow for diverse functionalization, making it a candidate for further chemical modifications. While specific physical properties such as melting point, boiling point, and solubility may vary, the compound's overall characteristics suggest potential utility in drug design and development, particularly in creating novel therapeutic agents. Further research is necessary to fully explore its biological activity and practical applications.
Formula:C9H18N2
InChI:InChI=1S/C9H18N2/c1-2-3-11-6-8-4-10-5-9(8)7-11/h8-10H,2-7H2,1H3
InChI key:InChIKey=VQPNFKCQRQGJPG-UHFFFAOYSA-N
SMILES:C(CC)N1CC2C(C1)CNC2
Synonyms:- Pyrrolo[3,4-c]pyrrole, octahydro-2-propyl-
- Octahydro-2-propylpyrrolo[3,4-c]pyrrole
- 5-propyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole
- 2-PROPYL-OCTAHYDRO-PYRROLO[3,4-C]PYRROLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

