CymitQuimica logo

CAS 954241-25-9

:

Ethyl 2-[(3-bromophenyl)methyl]-4-thiazolecarboxylate

Description:
Ethyl 2-[(3-bromophenyl)methyl]-4-thiazolecarboxylate is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of the ethyl ester group contributes to its solubility in organic solvents and potential reactivity in various chemical reactions. The 3-bromophenyl group introduces a bromine atom, which can enhance the compound's biological activity and influence its electronic properties. This compound may exhibit interesting pharmacological properties due to the combination of the thiazole and aromatic systems, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the substituents on the thiazole and phenyl rings, which may affect its interactions with other molecules. Overall, Ethyl 2-[(3-bromophenyl)methyl]-4-thiazolecarboxylate represents a unique structure that warrants investigation for its chemical and biological properties.
Formula:C13H12BrNO2S
InChI:InChI=1S/C13H12BrNO2S/c1-2-17-13(16)11-8-18-12(15-11)7-9-4-3-5-10(14)6-9/h3-6,8H,2,7H2,1H3
InChI key:InChIKey=QYBDMITUHPDCMC-UHFFFAOYSA-N
SMILES:C(C1=NC(C(OCC)=O)=CS1)C2=CC(Br)=CC=C2
Synonyms:
  • Ethyl 2-[(3-bromophenyl)methyl]-4-thiazolecarboxylate
  • 4-Thiazolecarboxylic acid, 2-[(3-bromophenyl)methyl]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.