CymitQuimica logo

CAS 954241-29-3

:

5,6-Dihydro-2-phenyl-4H-pyrrolo[3,4-d]thiazole

Description:
5,6-Dihydro-2-phenyl-4H-pyrrolo[3,4-d]thiazole is a heterocyclic compound characterized by its unique bicyclic structure, which includes both a pyrrole and a thiazole ring. This compound features a phenyl group attached to the pyrrole moiety, contributing to its aromatic properties. The presence of sulfur in the thiazole ring imparts distinct chemical reactivity, making it of interest in various synthetic applications. Typically, compounds of this nature exhibit biological activity, which may include antimicrobial or anticancer properties, although specific biological data for this compound may vary. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further pharmacological studies. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the rings, which may affect its application in medicinal chemistry or material science. Overall, 5,6-Dihydro-2-phenyl-4H-pyrrolo[3,4-d]thiazole represents a class of compounds that are valuable in research and development within the field of organic chemistry.
Formula:C11H10N2S
InChI:InChI=1S/C11H10N2S/c1-2-4-8(5-3-1)11-13-9-6-12-7-10(9)14-11/h1-5,12H,6-7H2
InChI key:InChIKey=IZHAHQIUNRBFRD-UHFFFAOYSA-N
SMILES:C1(=NC2=C(S1)CNC2)C3=CC=CC=C3
Synonyms:
  • 5,6-Dihydro-2-phenyl-4H-pyrrolo[3,4-d]thiazole
  • 2-Phenyl-4H,5H,6H-pyrrolo[3,4-d][1,3]thiazole
  • 4H-Pyrrolo[3,4-d]thiazole, 5,6-dihydro-2-phenyl-
  • 2-Phenyl-5,6-dihydro-4H-pyrrolo[3,4-d][1,3]thiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.