CymitQuimica logo

CAS 954264-30-3

:

N-(5-Amino-2-methylphenyl)-2-(4-chlorophenoxy)acetamide

Description:
N-(5-Amino-2-methylphenyl)-2-(4-chlorophenoxy)acetamide, identified by its CAS number 954264-30-3, is a chemical compound that features a complex structure characterized by the presence of an amine group, a chlorophenyl moiety, and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the amino group suggests it may engage in hydrogen bonding, enhancing its solubility in polar solvents. The chlorophenoxy group can influence its lipophilicity and reactivity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure may allow for interactions with biological targets, potentially leading to therapeutic applications. Additionally, the compound's stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C15H15ClN2O2
InChI:InChI=1S/C15H15ClN2O2/c1-10-2-5-12(17)8-14(10)18-15(19)9-20-13-6-3-11(16)4-7-13/h2-8H,9,17H2,1H3,(H,18,19)
InChI key:InChIKey=ZFYBWNMEIXWFKT-UHFFFAOYSA-N
SMILES:N(C(COC1=CC=C(Cl)C=C1)=O)C2=C(C)C=CC(N)=C2
Synonyms:
  • N-(5-Amino-2-methylphenyl)-2-(4-chlorophenoxy)acetamide
  • Acetamide, N-(5-amino-2-methylphenyl)-2-(4-chlorophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.