CAS 954266-85-4

N-(5-Amino-2-methylphenyl)-2-(4-methoxyphenoxy)acetamide

Description:

N-(5-Amino-2-methylphenyl)-2-(4-methoxyphenoxy)acetamide, identified by its CAS number 954266-85-4, is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. The structure features an aromatic amine, which contributes to its solubility and reactivity, as well as a methoxyphenyl group that may enhance its lipophilicity and interaction with biological targets. This compound is likely to exhibit properties typical of amides, such as moderate stability under physiological conditions and the ability to participate in hydrogen bonding due to the presence of the amino group. Its specific molecular interactions may make it a candidate for pharmaceutical applications, particularly in the development of therapeutic agents. The presence of both amino and methoxy groups suggests potential for diverse reactivity and biological activity, making it a subject of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₆H₁₈N₂O₃

InChI: InChI=1S/C16H18N2O3/c1-11-3-4-12(17)9-15(11)18-16(19)10-21-14-7-5-13(20-2)6-8-14/h3-9H,10,17H2,1-2H3,(H,18,19)

InChI key: InChIKey=IGTNSZPXWXSLDM-UHFFFAOYSA-N

SMILES: N(C(COC1=CC=C(OC)C=C1)=O)C2=C(C)C=CC(N)=C2

Synonyms:

• N-(5-Amino-2-methylphenyl)-2-(4-methoxyphenoxy)acetamide
• Acetamide, N-(5-amino-2-methylphenyl)-2-(4-methoxyphenoxy)-