CAS 954270-15-6

6-[(Pyrazine-2-carbonyl)-amino]-hexanoic acid

Description:

6-[(Pyrazine-2-carbonyl)-amino]-hexanoic acid, identified by its CAS number 954270-15-6, is an organic compound characterized by its unique structure that includes a hexanoic acid chain and a pyrazine moiety. This compound features an amino group attached to the carbon chain, which contributes to its potential as a building block in pharmaceutical and biochemical applications. The presence of the pyrazine ring, a heterocyclic aromatic compound, imparts specific electronic properties and can influence the compound's reactivity and solubility. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. The carboxylic acid functional group at one end of the hexanoic chain allows for potential interactions with other molecules, facilitating its role in various chemical reactions. Additionally, the compound's stability, solubility in polar solvents, and potential for forming hydrogen bonds are important characteristics that can affect its behavior in biological systems and its utility in drug design.

Formula: C₁₁H₁₅N₃O₃

InChI: InChI=1S/C11H15N3O3/c15-10(16)4-2-1-3-5-14-11(17)9-8-12-6-7-13-9/h6-8H,1-5H2,(H,14,17)(H,15,16)

InChI key: MXUTYVVUTJBKOF-UHFFFAOYSA-N

SMILES: C1=CN=C(C=N1)C(=O)NCCCCCC(=O)O

Synonyms:

• Hexanoic acid, 6-[(2-pyrazinylcarbonyl)amino]-
• 6-(Pyrazine-2-carboxamido)hexanoic acid
• 6-[(Pyrazine-2-carbonyl)-amino]-hexanoic acid
• 6-[(Pyrazin-2-yl)formamido]hexanoic acid