CAS 954272-88-9

N-(3-Aminophenyl)-2-(4-ethylphenoxy)propanamide

Description:

N-(3-Aminophenyl)-2-(4-ethylphenoxy)propanamide, identified by its CAS number 954272-88-9, is a chemical compound that features a propanamide backbone substituted with an amino group and a phenoxy group. This compound typically exhibits characteristics such as moderate solubility in organic solvents and potential interactions with biological systems due to the presence of the amino group, which can participate in hydrogen bonding and other interactions. The ethylphenoxy moiety may contribute to its hydrophobic properties, influencing its overall solubility and reactivity. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the amino and phenoxy groups can be critical for biological activity. Additionally, its molecular structure may allow for various synthetic modifications, making it a versatile candidate for further research in drug design and development. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₇H₂₀N₂O₂

InChI: InChI=1S/C17H20N2O2/c1-3-13-7-9-16(10-8-13)21-12(2)17(20)19-15-6-4-5-14(18)11-15/h4-12H,3,18H2,1-2H3,(H,19,20)

InChI key: InChIKey=XOTNPGOJHRZEGJ-UHFFFAOYSA-N

SMILES: O(C(C(NC1=CC(N)=CC=C1)=O)C)C2=CC=C(CC)C=C2

Synonyms:

• N-(3-Aminophenyl)-2-(4-ethylphenoxy)propanamide
• Propanamide, N-(3-aminophenyl)-2-(4-ethylphenoxy)-