CAS 954274-69-2

3-[(2-Methyl-4-morpholinyl)methyl]benzenemethanamine

Description:

3-[(2-Methyl-4-morpholinyl)methyl]benzenemethanamine, identified by its CAS number 954274-69-2, is a chemical compound characterized by its complex structure that includes a benzene ring substituted with a methanamine group and a morpholine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the morpholine ring contributes to its potential biological activity, as morpholines are often found in pharmaceuticals and can interact with biological targets. The methyl group on the morpholine enhances lipophilicity, potentially affecting the compound's pharmacokinetics. Additionally, the compound may exhibit moderate to high stability under standard conditions, but its reactivity can vary based on the functional groups present. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₃H₂₀N₂O

InChI: InChI=1S/C13H20N2O/c1-11-9-15(5-6-16-11)10-13-4-2-3-12(7-13)8-14/h2-4,7,11H,5-6,8-10,14H2,1H3

InChI key: InChIKey=QEQIEYOHDKYEOM-UHFFFAOYSA-N

SMILES: C(C1=CC(CN)=CC=C1)N2CC(C)OCC2

Synonyms:

• 3-[(2-Methyl-4-morpholinyl)methyl]benzenemethanamine
• Benzenemethanamine, 3-[(2-methyl-4-morpholinyl)methyl]-

{3-[(2-Methylmorpholin-4-yl)methyl]phenyl}methanamine

CAS: 954274-69-2

Versatile small molecule scaffold

Formula: C₁₃H₂₀N₂O

Purity: Min. 95%

Molecular weight: 220.31 g/mol

Ref: 3D-ENB27469