CAS 954275-95-7

6-Cyclopropyl-1-(4-pyridinylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

6-Cyclopropyl-1-(4-pyridinylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features a cyclopropyl group and a pyridinylmethyl substituent, contributing to its unique chemical properties. It is typically classified as a heterocyclic compound due to the presence of nitrogen atoms in its ring structures. The carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The compound is of interest in medicinal chemistry, potentially serving as a scaffold for the development of pharmaceuticals, particularly in the context of targeting specific biological pathways. Its structural features may also suggest potential interactions with biological macromolecules, making it a candidate for further research in drug discovery and development. As with many chemical substances, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₆H₁₄N₄O₂

InChI: InChI=1S/C16H14N4O2/c21-16(22)12-7-14(11-1-2-11)19-15-13(12)8-18-20(15)9-10-3-5-17-6-4-10/h3-8,11H,1-2,9H2,(H,21,22)

InChI key: InChIKey=RKQIQBKHEOBJEG-UHFFFAOYSA-N

SMILES: C(N1C=2C(=C(C(O)=O)C=C(N2)C3CC3)C=N1)C=4C=CN=CC4

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 6-cyclopropyl-1-(4-pyridinylmethyl)-
• 6-Cyclopropyl-1-(4-pyridinylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

6-Cyclopropyl-1-(pyridin-4-ylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

CAS: 954275-95-7

Versatile small molecule scaffold

Formula: C₁₆H₁₄N₄O₂

Purity: Min. 95%

Molecular weight: 294.31 g/mol

Ref: 3D-ENB27595