CymitQuimica logo

CAS 954326-01-3

:

5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxy-aniline

Description:
5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxy-aniline is an organic compound characterized by its unique structure, which includes an aniline moiety substituted with a methoxy group and an oxadiazole ring. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on pH and other factors. The methoxy group enhances the compound's lipophilicity, potentially influencing its interaction with biological membranes. Additionally, the ethyl substitution on the oxadiazole ring may affect the compound's electronic properties and reactivity. Overall, this compound's characteristics make it of interest in medicinal chemistry and materials science, where it may serve as a lead compound for further development or as a building block in synthetic applications. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H13N3O2
InChI:InChI=1/C11H13N3O2/c1-3-10-13-14-11(16-10)7-4-5-9(15-2)8(12)6-7/h4-6H,3,12H2,1-2H3
SMILES:CCc1nnc(c2ccc(c(c2)N)OC)o1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.