CAS 954328-84-8: 2,3-dimethyl-5-(tetrazol-1-yl)aniline

Description: 2,3-Dimethyl-5-(tetrazol-1-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a tetrazole functional group. The presence of two methyl groups at the 2 and 3 positions of the aniline ring contributes to its hydrophobic characteristics, while the tetrazole group enhances its potential for hydrogen bonding and increases its polarity. This compound typically exhibits moderate solubility in polar solvents due to the presence of the tetrazole moiety, which can engage in various interactions such as hydrogen bonding. The compound may also display interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 2,3-dimethyl-5-(tetrazol-1-yl)aniline represents a versatile compound with unique chemical properties suitable for various applications in research and industry.

Formula: C₉H₁₁N₅

InChI: InChI=1/C9H11N5/c1-6-3-8(4-9(10)7(6)2)14-5-11-12-13-14/h3-5H,10H2,1-2H3

2,3-dimethyl-5-(1H-tetrazol-1-yl)aniline

CAS: 954328-84-8

• Purity: 95.0%
• Molecular weight: 189.2220001220703

2,3-Dimethyl-5-(1H-tetrazol-1-yl)aniline

CAS: 954328-84-8

Versatile small molecule scaffold

• Formula: C₉H₁₁N₅
• Purity: Min. 95%
• Molecular weight: 189.22 g/mol