CAS 954369-08-5
:4-(2,2,2-Trifluoroethoxy)benzenesulfonyl chloride
Description:
4-(2,2,2-Trifluoroethoxy)benzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring, which is further substituted with a trifluoroethoxy group. This compound typically exhibits high reactivity due to the sulfonyl chloride moiety, making it useful in various chemical reactions, particularly in the synthesis of sulfonamides and other derivatives. The trifluoroethoxy group contributes to its unique properties, including increased lipophilicity and potential for enhanced biological activity. The presence of fluorine atoms often imparts stability and alters the electronic properties of the molecule, which can influence its reactivity and interactions with other substances. Additionally, this compound is likely to be a solid at room temperature and may require careful handling due to its reactive nature and potential toxicity. Proper safety measures should be observed when working with this chemical, including the use of personal protective equipment and working in a well-ventilated area or fume hood.
Formula:C8H6ClF3O3S
InChI:InChI=1S/C8H6ClF3O3S/c9-16(13,14)7-3-1-6(2-4-7)15-5-8(10,11)12/h1-4H,5H2
InChI key:InChIKey=CIUDMBYRPHOVNB-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC=C(OCC(F)(F)F)C=C1
Synonyms:- Benzenesulfonyl chloride, 4-(2,2,2-trifluoroethoxy)-
- 4-(2,2,2-Trifluoroethoxy)benzenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.