CymitQuimica logo

CAS 954373-95-6

:

1,2-Benziodoxole-3(1H)-one, 4,5,6,7-tetrafluoro-1-hydroxy-, 1-oxide

Description:
1,2-Benziodoxole-3(1H)-one, 4,5,6,7-tetrafluoro-1-hydroxy-, 1-oxide, commonly referred to as a benziodoxole derivative, is a chemical compound characterized by its unique structure that includes a benziodoxole core. This compound features a highly electronegative tetrafluorinated substituent, which significantly influences its reactivity and stability. The presence of the hydroxy group and the oxide functionality contributes to its potential as an oxidizing agent in various chemical reactions. Typically, compounds of this nature are utilized in organic synthesis, particularly in the formation of carbon-oxygen bonds and as intermediates in the synthesis of more complex molecules. The fluorine atoms enhance the compound's electrophilicity, making it a valuable reagent in synthetic organic chemistry. Additionally, its stability under various conditions and ability to participate in diverse chemical transformations make it a subject of interest in both academic and industrial research. Safety data and handling precautions should be observed due to its reactive nature.
Formula:C7HF4IO4
InChI:InChI=1S/C7HF4IO4/c8-2-1-6(5(11)4(10)3(2)9)12(14,15)16-7(1)13/h(H,14,15)
InChI key:InChIKey=OPFKDVCBUPHSII-UHFFFAOYSA-N
SMILES:O=C1C=2C(I(=O)(O)O1)=C(F)C(F)=C(F)C2F
Synonyms:
  • 1,2-Benziodoxole-3(1H)-one, 4,5,6,7-tetrafluoro-1-hydroxy-, 1-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.