CAS 95452-08-7
:1,1-Dimethyl-3-methylene-2-ethenylcyclohexane
Description:
1,1-Dimethyl-3-methylene-2-ethenylcyclohexane, with the CAS number 95452-08-7, is an organic compound characterized by its unique cyclohexane structure, which features two methyl groups and a methylene group attached to the cyclohexane ring. This compound is classified as a bicyclic alkene due to the presence of a double bond in its structure. Its molecular formula reflects the presence of carbon and hydrogen atoms, typical of hydrocarbons. The compound is likely to exhibit hydrophobic properties, making it insoluble in water but soluble in organic solvents. Its structure suggests potential reactivity typical of alkenes, such as undergoing addition reactions. Additionally, due to its specific arrangement of substituents, it may exhibit stereoisomerism, leading to different spatial configurations. The compound's physical properties, such as boiling point and melting point, would be influenced by its molecular weight and structural features. Overall, 1,1-Dimethyl-3-methylene-2-ethenylcyclohexane is of interest in organic synthesis and may have applications in the fragrance industry or as an intermediate in chemical reactions.
Formula:C11H18
InChI:InChI=1S/C11H18/c1-5-10-9(2)7-6-8-11(10,3)4/h5,10H,1-2,6-8H2,3-4H3
InChI key:InChIKey=YRBXRKRLOGXJAN-UHFFFAOYSA-N
SMILES:C(=C)C1C(C)(C)CCCC1=C
Synonyms:- Cyclohexane, 2-ethenyl-1,1-dimethyl-3-methylene-
- 2-Ethenyl-1,1-dimethyl-3-methylenecyclohexane
- 3-Methylene-1,1-dimethyl-2-ethenyl-cyclohexane
- 1,1-Dimethyl-3-methylene-2-ethenylcyclohexane
- 1,1-Dimethyl-3-methylene-2-vinycyclohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Ethenyl-1,1-dimethyl-3-methylenecyclohexane-D2,13C
CAS:Controlled ProductFormula:CC10D2H16Color and Shape:NeatMolecular weight:153.2662-Ethenyl-1,1-dimethyl-3-methylenecyclohexane
CAS:Controlled ProductFormula:C11H18Color and Shape:NeatMolecular weight:150.261
