CymitQuimica logo

CAS 954563-81-6

:

3-(Aminomethyl)-N-(cyclopropylmethyl)benzenesulfonamide

Description:
3-(Aminomethyl)-N-(cyclopropylmethyl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a benzene ring substituted with an aminomethyl group and a cyclopropylmethyl group, contributing to its unique structural and chemical properties. The presence of the sulfonamide moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting bacterial infections or other therapeutic areas. The compound's molecular structure may influence its solubility, stability, and reactivity, which are critical factors in drug design. Additionally, the cyclopropyl group can impart specific steric and electronic effects, potentially enhancing the compound's biological activity. Overall, 3-(Aminomethyl)-N-(cyclopropylmethyl)benzenesulfonamide represents a class of compounds that may exhibit significant pharmacological potential, warranting further investigation into its biological effects and mechanisms of action.
Formula:C11H16N2O2S
InChI:InChI=1S/C11H16N2O2S/c12-7-10-2-1-3-11(6-10)16(14,15)13-8-9-4-5-9/h1-3,6,9,13H,4-5,7-8,12H2
InChI key:InChIKey=MFCPFQLOHXWYOH-UHFFFAOYSA-N
SMILES:S(NCC1CC1)(=O)(=O)C2=CC(CN)=CC=C2
Synonyms:
  • Benzenesulfonamide, 3-(aminomethyl)-N-(cyclopropylmethyl)-
  • 3-(Aminomethyl)-N-(cyclopropylmethyl)benzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.