
CAS 954571-51-8
:3-(2-Aminoethyl)-6-fluoro-1,3-dihydro-2H-indol-2-one
Description:
3-(2-Aminoethyl)-6-fluoro-1,3-dihydro-2H-indol-2-one, with the CAS number 954571-51-8, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a fluoro substituent at the 6-position and an aminoethyl group at the 3-position, contributing to its unique properties. The presence of the amino group suggests potential for hydrogen bonding and reactivity, while the fluorine atom may influence the compound's lipophilicity and biological activity. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological properties, including effects on neurotransmitter systems. The dihydro form indicates that it may exist in a reduced state, which can affect its stability and reactivity. Overall, this compound's structural features suggest it may have applications in drug development or as a research tool in biochemical studies.
Formula:C10H11FN2O
InChI:InChI=1S/C10H11FN2O/c11-6-1-2-7-8(3-4-12)10(14)13-9(7)5-6/h1-2,5,8H,3-4,12H2,(H,13,14)
InChI key:InChIKey=SCKGJNVYCKPFJO-UHFFFAOYSA-N
SMILES:C(CN)C1C=2C(NC1=O)=CC(F)=CC2
Synonyms:- 3-(2-Aminoethyl)-6-fluoro-1,3-dihydro-2H-indol-2-one
- 2H-Indol-2-one, 3-(2-aminoethyl)-6-fluoro-1,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.