CAS 954577-98-1

N-(4-Amino-2-chlorophenyl)-2-ethoxyacetamide

Description:

N-(4-Amino-2-chlorophenyl)-2-ethoxyacetamide is a chemical compound characterized by its specific functional groups and structural features. It contains an amine group (-NH2), a chloro substituent on the aromatic ring, and an ethoxy group (-OCH2CH3) attached to an acetamide moiety. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine and ether functionalities. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the presence of the amino and chloro groups can influence biological activity. The compound may also participate in various chemical reactions, such as acylation or substitution, due to its reactive functional groups. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₀H₁₃ClN₂O₂

InChI: InChI=1S/C10H13ClN2O2/c1-2-15-6-10(14)13-9-4-3-7(12)5-8(9)11/h3-5H,2,6,12H2,1H3,(H,13,14)

InChI key: InChIKey=YJVBSZTXMQKJET-UHFFFAOYSA-N

SMILES: N(C(COCC)=O)C1=C(Cl)C=C(N)C=C1

Synonyms:

• Acetamide, N-(4-amino-2-chlorophenyl)-2-ethoxy-
• N-(4-Amino-2-chlorophenyl)-2-ethoxyacetamide