CAS 95480-61-8
:2-methoxy-4-(prop-2-en-1-yl)phenyl beta-D-glucopyranosiduronic acid
Description:
2-Methoxy-4-(prop-2-en-1-yl)phenyl beta-D-glucopyranosiduronic acid, with the CAS number 95480-61-8, is a complex organic compound characterized by its unique structural features. It contains a phenolic moiety substituted with a methoxy group and an allyl group, which contributes to its reactivity and potential biological activity. The presence of the beta-D-glucopyranosiduronic acid component indicates that it is a glycoside, suggesting that it may exhibit properties typical of sugars, such as solubility in water and potential interactions with biological systems. This compound may participate in various chemical reactions due to the presence of functional groups, including the methoxy and allyl substituents. Its structural complexity may also impart specific pharmacological properties, making it of interest in medicinal chemistry and biochemistry. Overall, the characteristics of this compound highlight its potential applications in research and industry, particularly in the fields of pharmaceuticals and natural product chemistry.
Formula:C16H20O8
InChI:InChI=1/C16H20O8/c1-3-4-8-5-6-9(10(7-8)22-2)23-16-13(19)11(17)12(18)14(24-16)15(20)21/h3,5-7,11-14,16-19H,1,4H2,2H3,(H,20,21)/t11-,12-,13+,14-,16+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Eugenol-β-D-glucuronide
CAS:Eugenol-glucuronide is an indirubin analog that has been found to have potent anticancer properties. It acts as a kinase inhibitor, blocking the activity of proteins that are involved in cancer cell growth and proliferation. Eugenol-glucuronide induces apoptosis, a process by which damaged or abnormal cells are eliminated from the body. It has been shown to be effective against human and Chinese hamster ovary tumor cells in vitro. This medicinal compound is excreted in urine and has potential for use in cancer treatment as an inhibitor of tumor growth.Formula:C16H20O8Purity:Min. 95%Molecular weight:340.32 g/molEugenol-glucuronide
CAS:Controlled ProductApplications Eugenol-glucuronide is a metabolite of Eugenol (E938640) formed in isolated rat hepatocytes.
References Thompson, David C., et al.: Chemico-Bio. Inter., 77(2), 137-47 (1991)Formula:C16H20O8Color and Shape:NeatMolecular weight:340.325

