CAS 954848-82-9

2-methyl-5-(1H-tetrazol-5-yl)aniline

Description:

2-Methyl-5-(1H-tetrazol-5-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a methyl group and a tetrazole ring. The presence of the tetrazole moiety contributes to its potential biological activity, as tetrazoles are known for their pharmacological properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of both hydrophobic (aromatic and methyl) and hydrophilic (tetrazole) components. Its molecular structure suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The aniline part of the structure indicates that it may act as a nucleophile in various chemical reactions. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the bioactive nature of both the aniline and tetrazole functionalities. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₈H₉N₅

InChI: InChI=1/C8H9N5/c1-5-2-3-6(4-7(5)9)8-10-12-13-11-8/h2-4H,9H2,1H3,(H,10,11,12,13)

SMILES: Cc1ccc(cc1N)c1n[nH]nn1

2-Methyl-5-(2H-tetrazol-5-yl)aniline

CAS: 954848-82-9

Versatile small molecule scaffold

Formula: C₈H₉N₅

Purity: Min. 95%

Molecular weight: 175.19 g/mol

Ref: 3D-ENB84882