CAS 955-15-7
:4-(3,5-dimethyl-1H-pyrazol-1-yl)benzenesulfonamide
Description:
4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzenesulfonamide, with the CAS number 955-15-7, is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring, which is further substituted with a pyrazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and may show limited solubility in non-polar solvents due to its polar sulfonamide group. The presence of the pyrazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly for its possible applications in pharmaceuticals. The compound may also exhibit various functional properties, including the ability to form hydrogen bonds, which can influence its reactivity and interactions with biological targets. Additionally, its molecular structure suggests potential for diverse chemical modifications, allowing for the exploration of derivatives with enhanced efficacy or selectivity in therapeutic applications. Overall, this compound represents a class of sulfonamide derivatives that are significant in both synthetic and medicinal chemistry.
Formula:C11H13N3O2S
InChI:InChI=1/C11H13N3O2S/c1-8-7-9(2)14(13-8)10-3-5-11(6-4-10)17(12,15)16/h3-7H,1-2H3,(H2,12,15,16)
SMILES:Cc1cc(C)n(c2ccc(cc2)S(=O)(=O)N)n1
Synonyms:- 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzene-1-sulfonamide
- benzenesulfonamide, 4-(3,5-dimethyl-1H-pyrazol-1-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzene-1-sulfonamide
CAS:4-(3,5-Dimethyl-1H-pyrazol-1-yl)benzenesulfonamide is a centrosymmetric molecule with a dimer in the central position. It has hydrogen bonds that form between two molecules of the same type. The molecule has two hydrogen atoms bonded to each oxygen atom on the sulfonamide group and one hydrogen atom bonded to each carbon atom on the benzene ring. This molecule also has coordinated bonds, which are formed when an electron is shared by two atoms. This molecule also has symmetry in its molecular structure and can be found in nature as a component of some enzymes.Formula:C11H13N3O2SPurity:Min. 95%Molecular weight:251.31 g/molRef: 3D-AAA95515
Discontinued product
