
CAS 95500-19-9
:Diethyldimethylammonium hydroxide
Description:
Diethyldimethylammonium hydroxide, with the CAS number 95500-19-9, is a quaternary ammonium compound characterized by its structure, which includes two ethyl groups and two methyl groups attached to a nitrogen atom, along with a hydroxide ion. This compound is typically encountered as a colorless to pale yellow liquid and is known for its strong basicity due to the presence of the hydroxide ion. It is soluble in water and polar organic solvents, making it useful in various applications, including as a surfactant, emulsifier, or in chemical synthesis. Diethyldimethylammonium hydroxide can exhibit antimicrobial properties, which may be beneficial in certain industrial and laboratory settings. However, like many quaternary ammonium compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its reactivity can lead to interactions with acids and other electrophiles, making it a versatile reagent in organic chemistry. Safety data sheets should be consulted for specific handling and exposure guidelines.
Formula:C6H16N·HO
InChI:InChI=1S/C6H16N.H2O/c1-5-7(3,4)6-2;/h5-6H2,1-4H3;1H2/q+1;/p-1
InChI key:InChIKey=JQDCIBMGKCMHQV-UHFFFAOYSA-M
SMILES:[N+](CC)(CC)(C)C.[OH-]
Synonyms:- Ethanaminium, N-ethyl-N,N-dimethyl-, hydroxide (1:1)
- Ethanaminium, N-ethyl-N,N-dimethyl-, hydroxide
- Dimethyldiethylammonium hydroxide
- Diethyldimethylammonium hydroxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

