
CAS 955027-74-4
:3-Piperidinemethanol, 3-methyl-, hydrochloride (1:1)
Description:
3-Piperidinemethanol, 3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a hydroxymethyl group (-CH2OH) at the 3-position of the piperidine ring contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. The methyl group at the same position enhances its lipophilicity, which can influence its biological activity and pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in laboratory and pharmaceutical applications. This compound may exhibit various biological activities, including potential use in the development of therapeutic agents. However, specific data on its toxicity, stability, and reactivity would require further investigation, as these properties can vary based on the context of use and formulation. Overall, 3-Piperidinemethanol, 3-methyl-, hydrochloride is of interest in both academic research and industrial applications.
Formula:C7H15NO·ClH
InChI:InChI=1S/C7H15NO.ClH/c1-7(6-9)3-2-4-8-5-7;/h8-9H,2-6H2,1H3;1H
InChI key:InChIKey=UXIXDMNTNWZQKI-UHFFFAOYSA-N
SMILES:C(O)C1(C)CCCNC1.Cl
Synonyms:- 3-Piperidinemethanol, 3-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(3-Methylpiperidin-3-yl)methanol hydrochloride
CAS:Formula:C7H16ClNOColor and Shape:SolidMolecular weight:165.66103-(Hydroxymethyl)-3-methylpiperidine hydrochloride
CAS:<p>3-(Hydroxymethyl)-3-methylpiperidine hydrochloride</p>Molecular weight:165.66104g/mol


