CAS 955287-40-8

3-amino-3-[4-(1-methylethyl)phenyl]propan-1-ol

Description:

3-amino-3-[4-(1-methylethyl)phenyl]propan-1-ol, with the CAS number 955287-40-8, is an organic compound characterized by its amino alcohol structure. This compound features a propanol backbone with an amino group (-NH2) and a hydroxyl group (-OH) attached to the same carbon atom, making it a chiral molecule. The presence of a 4-(1-methylethyl)phenyl group indicates that it has a bulky aromatic substituent, which can influence its physical and chemical properties, such as solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The molecular structure suggests that it may engage in hydrogen bonding due to the hydroxyl and amino groups, affecting its interactions in biological systems. Additionally, the compound's stereochemistry could play a significant role in its biological activity and pharmacokinetics, making it a subject of interest in medicinal chemistry.

Formula: C₁₂H₁₉NO

InChI: InChI=1/C12H19NO/c1-9(2)10-3-5-11(6-4-10)12(13)7-8-14/h3-6,9,12,14H,7-8,13H2,1-2H3

SMILES: CC(C)c1ccc(cc1)C(CCO)N

Synonyms:

• 3-Amino-3-(4-isopropylphenyl)propan-1-ol
• Benzenepropanol, Γ-Amino-4-(1-Methylethyl)-

3-Amino-3-(4-isopropyl-phenyl)-propan-1-ol

CAS: 955287-40-8

3-Amino-3-(4-isopropyl-phenyl)-propan-1-ol

Purity: ≥95%

Molecular weight: 193.29g/mol

Ref: 54-OR307626

3-Amino-3-[4-(propan-2-yl)phenyl]propan-1-ol

CAS: 955287-40-8

Versatile small molecule scaffold

Formula: C₁₂H₁₉NO

Purity: Min. 95%

Molecular weight: 193.28 g/mol

Ref: 3D-FNB28740