CAS 955287-52-2

2-(1,2,3,4-tetrahydroisoquinolin-1-yl)propane-1,3-diol

Description:

2-(1,2,3,4-tetrahydroisoquinolin-1-yl)propane-1,3-diol, with the CAS number 955287-52-2, is a chemical compound characterized by its unique structure that includes a tetrahydroisoquinoline moiety and a propane-1,3-diol backbone. This compound typically exhibits properties associated with both its isoquinoline and diol components, such as potential solubility in polar solvents due to the hydroxyl groups and the presence of a nitrogen atom in the isoquinoline ring, which can influence its reactivity and interaction with biological systems. The tetrahydroisoquinoline structure may impart certain pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of hydroxyl groups suggests that it could participate in hydrogen bonding, affecting its physical properties like melting point and boiling point. Overall, this compound may have applications in drug development or as a biochemical probe, although specific biological activities and interactions would require further investigation through experimental studies.

Formula: C₁₂H₁₇NO₂

InChI: InChI=1/C12H17NO2/c14-7-10(8-15)12-11-4-2-1-3-9(11)5-6-13-12/h1-4,10,12-15H,5-8H2

SMILES: c1ccc2c(c1)CCNC2C(CO)CO

Synonyms:

• 1,3-Propanediol, 2-(1,2,3,4-Tetrahydro-1-Isoquinolinyl)-
• 2-(1,2,3,4-Tetrahydroisoquinolin-1-yl)propane-1,3-diol
• 2-(1,2,3,4-TETRAHYDRO-ISOQUINOLIN-1-YL)-PROPANE-1,3-DIOL

2-(1,2,3,4-Tetrahydro-isoquinolin-1-yl)-propane-1,3-diol

CAS: 955287-52-2

2-(1,2,3,4-Tetrahydro-isoquinolin-1-yl)-propane-1,3-diol

Purity: ≥95%

Molecular weight: 207.27g/mol

Ref: 54-OR307638