CAS 955287-94-2
:3-(3-ethoxybenzyl)piperidine
Description:
3-(3-Ethoxybenzyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The structure features a benzyl group substituted with an ethoxy group at the meta position relative to the benzyl carbon. This compound is typically classified as an amine due to the presence of the piperidine nitrogen. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may exhibit properties such as analgesic or psychoactive effects. The presence of the ethoxy group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological targets. Additionally, the compound's solubility, stability, and reactivity can be affected by the functional groups present, making it a subject of interest in synthetic organic chemistry. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C14H21NO
InChI:InChI=1/C14H21NO/c1-2-16-14-7-3-5-12(10-14)9-13-6-4-8-15-11-13/h3,5,7,10,13,15H,2,4,6,8-9,11H2,1H3
Synonyms:- piperidine, 3-[(3-ethoxyphenyl)methyl]-
- 3-(3-Ethoxybenzyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.