CAS 955288-00-3

3-(5-fluoro-2-methoxybenzyl)piperidine

Description:

3-(5-Fluoro-2-methoxybenzyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The presence of a 5-fluoro-2-methoxybenzyl group indicates that a fluorine atom and a methoxy group are attached to a benzene ring, which is further linked to the piperidine structure. This compound may exhibit properties typical of piperidine derivatives, such as potential basicity due to the nitrogen atom, and it may also show biological activity, making it of interest in medicinal chemistry. The fluorine substitution can enhance lipophilicity and metabolic stability, while the methoxy group may influence the compound's electronic properties and steric hindrance. Overall, 3-(5-fluoro-2-methoxybenzyl)piperidine is likely to be a versatile compound with applications in drug development or as a research tool in various chemical and biological studies.

Formula: C₁₃H₁₈FNO

InChI: InChI=1/C13H18FNO/c1-16-13-5-4-12(14)8-11(13)7-10-3-2-6-15-9-10/h4-5,8,10,15H,2-3,6-7,9H2,1H3

SMILES: COc1ccc(cc1CC1CCCNC1)F

Synonyms:

• Piperidine, 3-[(5-Fluoro-2-Methoxyphenyl)Methyl]-